ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53222-52-9 4-({3-amino-4-[({4-[(1-methylpyridinium-4-yl)amino]phenyl}carbonyl)amino]phenyl}amino)-1-methylchinoliniumdibromid |
|
| Produkt-Name | 4-({3-amino-4-[({4-[(1-methylpyridinium-4-yl)amino]phenyl}carbonyl)amino]phenyl}amino)-1-methylchinoliniumdibromid |
| Synonyme | ; |
| Englischer Name | 4-({3-amino-4-[({4-[(1-methylpyridinium-4-yl)amino]phenyl}carbonyl)amino]phenyl}amino)-1-methylquinolinium dibromide; |
| Molekulare Formel | C29H28Br2N6O |
| Molecular Weight | 636.3802 |
| InChl | InChI=1/C29H26N6O.2BrH/c1-34-16-13-22(14-17-34)31-21-9-7-20(8-10-21)29(36)33-27-12-11-23(19-25(27)30)32-26-15-18-35(2)28-6-4-3-5-24(26)28;;/h3-19H,30H2,1-2H3,(H,33,36);2*1H |
| CAS Registry Number | 53222-52-9 |
| Molecular Structure | ![]() |
| MSDS | |