ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53265-23-9 4-ethyl-2H-pyrazino[2,3-b][1,4]thiazin-3(4H)-one |
|
| Produkt-Name | 4-ethyl-2H-pyrazino[2,3-b][1,4]thiazin-3(4H)-one |
| Englischer Name | 4-ethyl-2H-pyrazino[2,3-b][1,4]thiazin-3(4H)-one; |
| Molekulare Formel | C8H9N3OS |
| Molecular Weight | 195.2416 |
| InChl | InChI=1/C8H9N3OS/c1-2-11-6(12)5-13-8-7(11)9-3-4-10-8/h3-4H,2,5H2,1H3 |
| CAS Registry Number | 53265-23-9 |
| Molecular Structure | ![]() |
| Dichte | 1.325g/cm3 |
| Siedepunkt | 443.1°C at 760 mmHg |
| Brechungsindex | 1.611 |
| Flammpunkt | 221.8°C |
| Dampfdruck | 4.77E-08mmHg at 25°C |
| MSDS | |