ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53744-50-6 4-(1-hydroxyethyl)phenylacetat |
|
| Produkt-Name | 4-(1-hydroxyethyl)phenylacetat |
| Synonyme | ; 4-(1-Hydroxyethyl)phenylacetat; Benzolemethanol, 4-(Acetyloxy)-alpha-methyl-; |
| Englischer Name | 4-(1-hydroxyethyl)phenyl acetate;4-(1-Hydroxyethyl)phenyl acetate;benzenemethanol, 4-(acetyloxy)-alpha-methyl- |
| Molekulare Formel | C10H12O3 |
| Molecular Weight | 180.2005 |
| InChl | InChI=1/C10H12O3/c1-7(11)9-3-5-10(6-4-9)13-8(2)12/h3-7,11H,1-2H3 |
| CAS Registry Number | 53744-50-6 |
| Molecular Structure | ![]() |
| Dichte | 1.139g/cm3 |
| Siedepunkt | 290.4°C at 760 mmHg |
| Brechungsindex | 1.527 |
| Flammpunkt | 122.4°C |
| Dampfdruck | 0.000957mmHg at 25°C |
| MSDS | |