ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53983-18-9 4,6-Diphenyl-1,3,5-thiadiazinan-2-thion |
|
| Produkt-Name | 4,6-Diphenyl-1,3,5-thiadiazinan-2-thion |
| Englischer Name | 4,6-diphenyl-1,3,5-thiadiazinane-2-thione; |
| Molekulare Formel | C15H14N2S2 |
| Molecular Weight | 286.4151 |
| InChl | InChI=1/C15H14N2S2/c18-15-17-13(11-7-3-1-4-8-11)16-14(19-15)12-9-5-2-6-10-12/h1-10,13-14,16H,(H,17,18) |
| CAS Registry Number | 53983-18-9 |
| Molecular Structure | ![]() |
| Dichte | 1.32g/cm3 |
| Siedepunkt | 455.3°C at 760 mmHg |
| Brechungsindex | 1.721 |
| Flammpunkt | 229.2°C |
| Dampfdruck | 1.77E-08mmHg at 25°C |
| MSDS | |