ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-77-3 1,1-Dimethyl-4-phenylpiperaziniumiodid |
|
| Produkt-Name | 1,1-Dimethyl-4-phenylpiperaziniumiodid |
| Synonyme | 1,1-Dimethyl-4-phenylpiperazin-1-iumiodid; |
| Englischer Name | 1,1-Dimethyl-4-phenylpiperazinium iodide;1,1-dimethyl-4-phenylpiperazin-1-ium iodide |
| Molekulare Formel | C12H19IN2 |
| Molecular Weight | 318.1971 |
| InChl | InChI=1/C12H19N2.HI/c1-14(2)10-8-13(9-11-14)12-6-4-3-5-7-12;/h3-7H,8-11H2,1-2H3;1H/q+1;/p-1 |
| CAS Registry Number | 54-77-3 |
| EINECS | 200-213-0 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 234-238℃ |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |