ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54649-06-8 4-cyclohexyl-5-[(2-methyl-1H-indol-3-yl)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione |
|
| Produkt-Name | 4-cyclohexyl-5-[(2-methyl-1H-indol-3-yl)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Englischer Name | 4-cyclohexyl-5-[(2-methyl-1H-indol-3-yl)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione; |
| Molekulare Formel | C18H22N4S |
| Molecular Weight | 326.4591 |
| InChl | InChI=1/C18H22N4S/c1-12-15(14-9-5-6-10-16(14)19-12)11-17-20-21-18(23)22(17)13-7-3-2-4-8-13/h5-6,9-10,13,19H,2-4,7-8,11H2,1H3,(H,21,23) |
| CAS Registry Number | 54649-06-8 |
| Molecular Structure | ![]() |
| Dichte | 1.35g/cm3 |
| Siedepunkt | 505°C at 760 mmHg |
| Brechungsindex | 1.723 |
| Flammpunkt | 259.2°C |
| Dampfdruck | 2.52E-10mmHg at 25°C |
| MSDS | |