ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55168-28-0 4-Hexylphenylacetat |
|
| Produkt-Name | 4-Hexylphenylacetat |
| Synonyme | ; |
| Englischer Name | 4-hexylphenyl acetate; |
| Molekulare Formel | C14H20O2 |
| Molecular Weight | 220.3074 |
| InChl | InChI=1/C14H20O2/c1-3-4-5-6-7-13-8-10-14(11-9-13)16-12(2)15/h8-11H,3-7H2,1-2H3 |
| CAS Registry Number | 55168-28-0 |
| Molecular Structure | ![]() |
| Dichte | 0.975g/cm3 |
| Siedepunkt | 304.9°C at 760 mmHg |
| Brechungsindex | 1.493 |
| Flammpunkt | 109.2°C |
| Dampfdruck | 0.00085mmHg at 25°C |
| MSDS | |