ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55299-09-7 4',5,6-trichlor-2-hydroxy-N-phenylbiphenyl-3-carboxamid |
|
| Produkt-Name | 4',5,6-trichlor-2-hydroxy-N-phenylbiphenyl-3-carboxamid |
| Englischer Name | 4',5,6-trichloro-2-hydroxy-N-phenylbiphenyl-3-carboxamide; |
| Molekulare Formel | C19H12Cl3NO2 |
| Molecular Weight | 392.6631 |
| InChl | InChI=1/C19H12Cl3NO2/c20-12-8-6-11(7-9-12)16-17(22)15(21)10-14(18(16)24)19(25)23-13-4-2-1-3-5-13/h1-10,24H,(H,23,25) |
| CAS Registry Number | 55299-09-7 |
| Molecular Structure | ![]() |
| Dichte | 1.465g/cm3 |
| Siedepunkt | 481.5°C at 760 mmHg |
| Brechungsindex | 1.686 |
| Flammpunkt | 245°C |
| Dampfdruck | 6.8E-10mmHg at 25°C |
| MSDS | |