ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-55-3 1,2-Benzanthracene |
|
| Produkt-Name | 1,2-Benzanthracene |
| Englischer Name | 1,2-Benzanthracene;1,2-benzanthrene;2,3-benzophenanthracene;2,3-benzophenanthrene;B(A)A;benz[a]anthracene;Benz[a]anthracene;Benzanthracene;benzanthrene;Benzo[a]anthracene;Benzo[b]phenanthrene;naphthanthracene;tetraphene |
| Molekulare Formel | C18H12 |
| Molecular Weight | 228.2879 |
| InChl | InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
| CAS Registry Number | 56-55-3 |
| EINECS | 200-280-6 |
| Molecular Structure | ![]() |
| Dichte | 1.19g/cm3 |
| Schmelzpunkt | 158-161℃ |
| Siedepunkt | 436.7°C at 760 mmHg |
| Brechungsindex | 1.771 |
| Flammpunkt | 209.1°C |
| Wasserlöslichkeit | 0.0000014 g/100 mL |
| Dampfdruck | 2.02E-07mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R45##May cause cancer.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Safety Beschreibung | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |