ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56276-49-4 3-Phenylazoacetylacetone |
|
Produkt-Name | 3-Phenylazoacetylacetone |
Englischer Name | 3-Phenylazoacetylacetone;3-Phenylazoacethylacetone;3-Phenylazo-2,4-pentanedione;3-[(E)-phenyldiazenyl]pentane-2,4-dione |
Molekulare Formel | C11H12N2O2 |
Molecular Weight | 204.2252 |
InChl | InChI=1/C11H12N2O2/c1-8(14)11(9(2)15)13-12-10-6-4-3-5-7-10/h3-7,11H,1-2H3/b13-12+ |
CAS Registry Number | 56276-49-4 |
EINECS | 260-089-9 |
Molecular Structure | ![]() |
Dichte | 1.11g/cm3 |
Schmelzpunkt | 86-90℃ |
Siedepunkt | 269.2°C at 760 mmHg |
Brechungsindex | 1.546 |
Flammpunkt | 107.9°C |
Dampfdruck | 0.00735mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |