ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56434-43-6 4-Ethyl-2-methyl-4-nitrodecahydropyrido[1,2-a][1,4]diazepin |
|
| Produkt-Name | 4-Ethyl-2-methyl-4-nitrodecahydropyrido[1,2-a][1,4]diazepin |
| Synonyme | ; |
| Englischer Name | 4-ethyl-2-methyl-4-nitrodecahydropyrido[1,2-a][1,4]diazepine; |
| Molekulare Formel | C12H23N3O2 |
| Molecular Weight | 241.3299 |
| InChl | InChI=1/C12H23N3O2/c1-3-12(15(16)17)9-13(2)8-11-6-4-5-7-14(11)10-12/h11H,3-10H2,1-2H3 |
| CAS Registry Number | 56434-43-6 |
| Molecular Structure | ![]() |
| Dichte | 1.11g/cm3 |
| Siedepunkt | 339.2°C at 760 mmHg |
| Brechungsindex | 1.536 |
| Flammpunkt | 158.9°C |
| Dampfdruck | 9.37E-05mmHg at 25°C |
| MSDS | |