ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56670-20-3 4-Dimethylamino-2-nitrobenzaldehyd |
|
| Produkt-Name | 4-Dimethylamino-2-nitrobenzaldehyd |
| Englischer Name | 4-Dimethylamino-2-nitrobenzaldehyde; |
| Molekulare Formel | C9H10N2O3 |
| Molecular Weight | 194.1873 |
| InChl | InChI=1/C9H10N2O3/c1-10(2)8-4-3-7(6-12)9(5-8)11(13)14/h3-6H,1-2H3 |
| CAS Registry Number | 56670-20-3 |
| Molecular Structure | ![]() |
| Dichte | 1.286g/cm3 |
| Schmelzpunkt | 117℃ |
| Siedepunkt | 365.5°C at 760 mmHg |
| Brechungsindex | 1.632 |
| Flammpunkt | 174.8°C |
| Dampfdruck | 1.57E-05mmHg at 25°C |
| MSDS | |