ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56933-74-5 4-Ethyl-5-(4-methoxyphenyl)-7a-methyl-2,6,7,7a-tetrahydro-1H-inden-1-on |
|
| Produkt-Name | 4-Ethyl-5-(4-methoxyphenyl)-7a-methyl-2,6,7,7a-tetrahydro-1H-inden-1-on |
| Synonyme | 1H-Inden-1-on, 4-ethyl-2,6,7,7a-tetrahydro-5-(4-methoxyphenyl)-7a-methyl-; |
| Englischer Name | 4-ethyl-5-(4-methoxyphenyl)-7a-methyl-2,6,7,7a-tetrahydro-1H-inden-1-one;1H-Inden-1-one, 4-ethyl-2,6,7,7a-tetrahydro-5-(4-methoxyphenyl)-7a-methyl- |
| Molekulare Formel | C19H22O2 |
| Molecular Weight | 282.3768 |
| InChl | InChI=1/C19H22O2/c1-4-15-16(13-5-7-14(21-3)8-6-13)11-12-19(2)17(15)9-10-18(19)20/h5-9H,4,10-12H2,1-3H3 |
| CAS Registry Number | 56933-74-5 |
| Molecular Structure | ![]() |
| Dichte | 1.1g/cm3 |
| Siedepunkt | 431.7°C at 760 mmHg |
| Brechungsindex | 1.572 |
| Flammpunkt | 185.4°C |
| Dampfdruck | 1.18E-07mmHg at 25°C |
| MSDS | |