ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57235-35-5 4,6-Dimethoxy-2-Mercaptopyrimidine |
|
| Produkt-Name | 4,6-Dimethoxy-2-Mercaptopyrimidine |
| Englischer Name | 4,6-Dimethoxy-2-Mercaptopyrimidine;2-pyrimidinethiol, 4,6-dimethoxy-;4,6-Dimethoxypyrimidine-2-thiol;4,6-dimethoxypyrimidine-2(1H)-thione |
| Molekulare Formel | C6H8N2O2S |
| Molecular Weight | 172.2049 |
| InChl | InChI=1/C6H8N2O2S/c1-9-4-3-5(10-2)8-6(11)7-4/h3H,1-2H3,(H,7,8,11) |
| CAS Registry Number | 57235-35-5 |
| Molecular Structure | ![]() |
| Dichte | 1.32g/cm3 |
| Siedepunkt | 250.9°C at 760 mmHg |
| Brechungsindex | 1.584 |
| Flammpunkt | 105.6°C |
| Dampfdruck | 0.0211mmHg at 25°C |
| MSDS | |