ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57456-67-4 4-Methyl-1a,2,3,11b-tetrahydrotetrapheno[10,11-b]oxiren-2,3-diol |
|
| Produkt-Name | 4-Methyl-1a,2,3,11b-tetrahydrotetrapheno[10,11-b]oxiren-2,3-diol |
| Synonyme | ; 1a,2,3,11b-Tetrahydro-4-methylbenz(7,8)anthra(1,2-b)oxiren-2,3-diol; Benz(7,8)anthra(1,2-b)oxiren-2,3-diol, 1a,2,3,11b-tetrahydro-4-methyl-; |
| Englischer Name | 4-methyl-1a,2,3,11b-tetrahydrotetrapheno[10,11-b]oxirene-2,3-diol;1a,2,3,11b-Tetrahydro-4-methylbenz(7,8)anthra(1,2-b)oxirene-2,3-diol;Benz(7,8)anthra(1,2-b)oxirene-2,3-diol, 1a,2,3,11b-tetrahydro-4-methyl- |
| Molekulare Formel | C19H16O3 |
| Molecular Weight | 292.3285 |
| InChl | InChI=1/C19H16O3/c1-9-11-7-6-10-4-2-3-5-12(10)13(11)8-14-15(9)16(20)17(21)19-18(14)22-19/h2-8,16-21H,1H3 |
| CAS Registry Number | 57456-67-4 |
| Molecular Structure | ![]() |
| Dichte | 1.429g/cm3 |
| Siedepunkt | 571.5°C at 760 mmHg |
| Brechungsindex | 1.786 |
| Flammpunkt | 299.4°C |
| Dampfdruck | 6.74E-14mmHg at 25°C |
| MSDS | |