ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58337-23-8 4-Oxo-2-(phenylamino)-4,5-dihydrofuran-3-carbonsäure |
|
| Produkt-Name | 4-Oxo-2-(phenylamino)-4,5-dihydrofuran-3-carbonsäure |
| Englischer Name | 4-oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylic acid; |
| Molekulare Formel | C11H9NO4 |
| Molecular Weight | 219.1935 |
| InChl | InChI=1/C11H9NO4/c13-8-6-16-10(9(8)11(14)15)12-7-4-2-1-3-5-7/h1-5,12H,6H2,(H,14,15) |
| CAS Registry Number | 58337-23-8 |
| Molecular Structure | ![]() |
| Dichte | 1.535g/cm3 |
| Siedepunkt | 364.2°C at 760 mmHg |
| Brechungsindex | 1.699 |
| Flammpunkt | 174.1°C |
| Dampfdruck | 6.05E-06mmHg at 25°C |
| MSDS | |