ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58374-97-3 4-methoxy[1]benzothieno[3,2-d][1,2,3]triazine |
|
| Produkt-Name | 4-methoxy[1]benzothieno[3,2-d][1,2,3]triazine |
| Englischer Name | 4-methoxy[1]benzothieno[3,2-d][1,2,3]triazine; |
| Molekulare Formel | C10H7N3OS |
| Molecular Weight | 217.2471 |
| InChl | InChI=1/C10H7N3OS/c1-14-10-9-8(11-13-12-10)6-4-2-3-5-7(6)15-9/h2-5H,1H3 |
| CAS Registry Number | 58374-97-3 |
| Molecular Structure | ![]() |
| Dichte | 1.44g/cm3 |
| Siedepunkt | 429.6°C at 760 mmHg |
| Brechungsindex | 1.747 |
| Flammpunkt | 213.6°C |
| Dampfdruck | 3.46E-07mmHg at 25°C |
| MSDS | |