ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58573-87-8 4'-Heptylbiphenyl-4-carbonylchlorid |
|
| Produkt-Name | 4'-Heptylbiphenyl-4-carbonylchlorid |
| Synonyme | ;(1,1'-Biphenyl)-4-carbonylchlorid, 4'-heptyl-; [1,1'-biphenyl]-4-carbonylchlorid, 4'-heptyl-; 4'-Heptylbiphenyl-4-carbonylchlorid; p-Heptylbiphenyl-p'-carbonylchlorid; |
| Englischer Name | 4'-heptylbiphenyl-4-carbonyl chloride;(1,1'-Biphenyl)-4-carbonyl chloride, 4'-heptyl-;[1,1'-biphenyl]-4-carbonyl chloride, 4'-heptyl-;4'-Heptylbiphenyl-4-carbonyl chloride;p-Heptylbiphenyl-p'-carbonyl chloride |
| Molekulare Formel | C20H23ClO |
| Molecular Weight | 314.849 |
| InChl | InChI=1/C20H23ClO/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)20(21)22/h8-15H,2-7H2,1H3 |
| CAS Registry Number | 58573-87-8 |
| Molecular Structure | ![]() |
| Dichte | 1.061g/cm3 |
| Siedepunkt | 427.9°C at 760 mmHg |
| Brechungsindex | 1.545 |
| Flammpunkt | 210.9°C |
| Dampfdruck | 1.58E-07mmHg at 25°C |
| MSDS | |