ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58754-40-8 4-methoxy-N-{2-[2-(piperidin-2-yl)ethyl]phenyl}benzamide |
|
| Produkt-Name | 4-methoxy-N-{2-[2-(piperidin-2-yl)ethyl]phenyl}benzamide |
| Englischer Name | 4-methoxy-N-{2-[2-(piperidin-2-yl)ethyl]phenyl}benzamide; |
| Molekulare Formel | C21H26N2O2 |
| Molecular Weight | 338.4433 |
| InChl | InChI=1/C21H26N2O2/c1-25-19-13-10-17(11-14-19)21(24)23-20-8-3-2-6-16(20)9-12-18-7-4-5-15-22-18/h2-3,6,8,10-11,13-14,18,22H,4-5,7,9,12,15H2,1H3,(H,23,24) |
| CAS Registry Number | 58754-40-8;87085-10-7 |
| Molecular Structure | ![]() |
| Dichte | 1.114g/cm3 |
| Siedepunkt | 443.6°C at 760 mmHg |
| Brechungsindex | 1.582 |
| Flammpunkt | 222.1°C |
| Dampfdruck | 4.57E-08mmHg at 25°C |
| MSDS | |