ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58943-52-5 4-Butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl-2-nitrobenzoat |
|
| Produkt-Name | 4-Butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl-2-nitrobenzoat |
| Englischer Name | 4-butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl 2-nitrobenzoate; |
| Molekulare Formel | C26H23N3O5 |
| Molecular Weight | 457.4779 |
| InChl | InChI=1/C26H23N3O5/c1-2-3-16-22-24(30)27(19-12-6-4-7-13-19)28(20-14-8-5-9-15-20)25(22)34-26(31)21-17-10-11-18-23(21)29(32)33/h4-15,17-18H,2-3,16H2,1H3 |
| CAS Registry Number | 58943-52-5 |
| Molecular Structure | ![]() |
| Dichte | 1.35g/cm3 |
| Siedepunkt | 597.5°C at 760 mmHg |
| Brechungsindex | 1.671 |
| Flammpunkt | 315.2°C |
| Dampfdruck | 3.06E-14mmHg at 25°C |
| MSDS | |