ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59007-04-4 4'-Methoxy[1,1'-biphenyl]-2,5-diol |
|
| Produkt-Name | 4'-Methoxy[1,1'-biphenyl]-2,5-diol |
| Synonyme | 4'-Methoxy(1,1'-biphenyl)-2,5-diol; 4'-Methoxybiphenyl-2,5-diol; |
| Englischer Name | 4'-methoxy[1,1'-biphenyl]-2,5-diol;4'-Methoxy(1,1'-biphenyl)-2,5-diol;4'-methoxybiphenyl-2,5-diol |
| Molekulare Formel | C13H12O3 |
| Molecular Weight | 216.2326 |
| InChl | InChI=1/C13H12O3/c1-16-11-5-2-9(3-6-11)12-8-10(14)4-7-13(12)15/h2-8,14-15H,1H3 |
| CAS Registry Number | 59007-04-4 |
| EINECS | 261-554-9 |
| Molecular Structure | ![]() |
| Dichte | 1.231g/cm3 |
| Siedepunkt | 415.6°C at 760 mmHg |
| Brechungsindex | 1.615 |
| Flammpunkt | 205.2°C |
| Dampfdruck | 1.69E-07mmHg at 25°C |
| MSDS | |