ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59229-75-3 4-Nitro-2,6-toluoldiamin |
|
| Produkt-Name | 4-Nitro-2,6-toluoldiamin |
| Synonyme | 2,6-Diamino-4-nitrotoluol; CCRIS 5188; 4-Nitro-2,6-toluoldiamin; 2-Methyl-5-nitrobenzol-1,3-diamin; |
| Englischer Name | 4-nitro-2,6-toluenediamine;2,6-Diamino-4-nitrotoluene;CCRIS 5188;4-Nitro-2,6-toluenediamine;2-methyl-5-nitrobenzene-1,3-diamine |
| Molekulare Formel | C7H9N3O2 |
| Molecular Weight | 167.1653 |
| InChl | InChI=1/C7H9N3O2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,8-9H2,1H3 |
| CAS Registry Number | 59229-75-3 |
| EINECS | 261-669-4 |
| Molecular Structure | ![]() |
| Dichte | 1.369g/cm3 |
| Siedepunkt | 432.5°C at 760 mmHg |
| Brechungsindex | 1.679 |
| Flammpunkt | 215.4°C |
| Dampfdruck | 1.1E-07mmHg at 25°C |
| MSDS | |