ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59338-91-9 4,5-Diamino-o-anisinsäure |
|
| Produkt-Name | 4,5-Diamino-o-anisinsäure |
| Synonyme | 4,5-Diamino-o-anissäure; 4,5-Diamino-2-methoxybenzoesäure; |
| Englischer Name | 4,5-diamino-o-anisic acid;4,5-Diamino-o-anisic acid;4,5-diamino-2-methoxybenzoic acid |
| Molekulare Formel | C8H10N2O3 |
| Molecular Weight | 182.1766 |
| InChl | InChI=1/C8H10N2O3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,9-10H2,1H3,(H,11,12) |
| CAS Registry Number | 59338-91-9 |
| EINECS | 261-708-5 |
| Molecular Structure | ![]() |
| Dichte | 1.395g/cm3 |
| Siedepunkt | 430.4°C at 760 mmHg |
| Brechungsindex | 1.662 |
| Flammpunkt | 214.1°C |
| Dampfdruck | 3.58E-08mmHg at 25°C |
| MSDS | |