ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59748-34-4 4'-Pentyl[1,1'-biphenyl]-4-yl4-butylbenzoat |
|
| Produkt-Name | 4'-Pentyl[1,1'-biphenyl]-4-yl4-butylbenzoat |
| Synonyme | Benzoesäure, 4-Butyl-, 4'-Pentyl(1,1'-biphenyl)-4-ylester; 4-(4-n-Butylbenzoyloxy)-4'-n-pentylbiphenyl; 4-n-Pentyl-4'-(4-n-butylbenzoyloxy)biphenyl; 4'-Pentyl(1,1'-biphenyl)-4-yl4-butylbenzoat; 4'-Pentylbiphenyl-4-yl-4-butylbenzoat; |
| Englischer Name | 4'-pentyl[1,1'-biphenyl]-4-yl 4-butylbenzoate;Benzoic acid, 4-butyl-, 4'-pentyl(1,1'-biphenyl)-4-yl ester;4-(4-n-Butylbenzoyloxy)-4'-n-pentylbiphenyl;4-n-Pentyl-4'-(4-n-butylbenzoyloxy)biphenyl;4'-Pentyl(1,1'-biphenyl)-4-yl 4-butylbenzoate;4'-pentylbiphenyl-4-yl 4-butylbenzoate |
| Molekulare Formel | C28H32O2 |
| Molecular Weight | 400.5525 |
| InChl | InChI=1/C28H32O2/c1-3-5-7-9-23-10-14-24(15-11-23)25-18-20-27(21-19-25)30-28(29)26-16-12-22(13-17-26)8-6-4-2/h10-21H,3-9H2,1-2H3 |
| CAS Registry Number | 59748-34-4 |
| EINECS | 261-910-3 |
| Molecular Structure | ![]() |
| Dichte | 1.036g/cm3 |
| Siedepunkt | 536.6°C at 760 mmHg |
| Brechungsindex | 1.559 |
| Flammpunkt | 226.7°C |
| Dampfdruck | 1.38E-11mmHg at 25°C |
| MSDS | |