ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-51-8 N,N-Diethyltryptamin |
|
| Produkt-Name | N,N-Diethyltryptamin |
| Synonyme | 3-(2-Diethylaminoethyl)indol; 5-22-10-00050 (Beilstein-Handbuch-Referenz); BRN 0153320; DET; Diethyltryptamin; 1H-Indol-3-ethanamin, N,N-Diethyl- (9CI); Indol, 3-(2-(diethylamino)ethyl)-; DEA-Nr.7434; N,N-Diethyl-2-(1H-indol-3-yl)ethanamin; |
| Englischer Name | N,N-Diethyltryptamine;3-(2-Diethylaminoethyl)indole;5-22-10-00050 (Beilstein Handbook Reference);BRN 0153320;DET;Diethyltryptamine;1H-Indole-3-ethanamine, N,N-diethyl- (9CI);Indole, 3-(2-(diethylamino)ethyl)-;DEA No. 7434;N,N-diethyl-2-(1H-indol-3-yl)ethanamine |
| Molekulare Formel | C14H20N2 |
| Molecular Weight | 216.322 |
| InChl | InChI=1/C14H20N2/c1-3-16(4-2)10-9-12-11-15-14-8-6-5-7-13(12)14/h5-8,11,15H,3-4,9-10H2,1-2H3 |
| CAS Registry Number | 61-51-8 |
| Molecular Structure | ![]() |
| Dichte | 1.04g/cm3 |
| Siedepunkt | 359.8°C at 760 mmHg |
| Brechungsindex | 1.591 |
| Flammpunkt | 171.4°C |
| Dampfdruck | 2.31E-05mmHg at 25°C |
| MSDS | |