ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71486-45-8 Octansäure, Verbindung mit N-Methylcyclohexylamin (1:1) |
|
Produkt-Name | Octansäure, Verbindung mit N-Methylcyclohexylamin (1:1) |
Synonyme | Octansäure, Verbindung mit N-Methylcyclohexylamin (1:1); N-Methylcyclohexanamin; Octansäure; |
Englischer Name | octanoic acid, compound with N-methylcyclohexylamine (1:1);Octanoic acid, compound with N-methylcyclohexylamine (1:1);N-methylcyclohexanamine; octanoic acid |
Molekulare Formel | C15H31NO2 |
Molecular Weight | 257.4121 |
InChl | InChI=1/C8H16O2.C7H15N/c1-2-3-4-5-6-7-8(9)10;1-8-7-5-3-2-4-6-7/h2-7H2,1H3,(H,9,10);7-8H,2-6H2,1H3 |
CAS Registry Number | 71486-45-8 |
EINECS | 275-518-5 |
Molecular Structure | ![]() |
Siedepunkt | 388°C at 760 mmHg |
Flammpunkt | 188.4°C |
Dampfdruck | 4.25E-07mmHg at 25°C |
MSDS |