ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71501-21-8 Methylhydrogensulfat, Verbindung mit N,N,2-Trimethylchinolin-6-amin (1:1) |
|
Produkt-Name | Methylhydrogensulfat, Verbindung mit N,N,2-Trimethylchinolin-6-amin (1:1) |
Synonyme | Methylhydrogensulfat, Verbindung mit N,N,2-Trimethylchinolin-6-amin (1:1); Methylhydrogensulfat; N,N,2-Trimethylchinolin-6-amin; |
Englischer Name | methyl hydrogen sulphate, compound with N,N,2-trimethylquinolin-6-amine (1:1);Methyl hydrogen sulphate, compound with N,N,2-trimethylquinolin-6-amine (1:1);methyl hydrogen sulfate; N,N,2-trimethylquinolin-6-amine |
Molekulare Formel | C13H18N2O4S |
Molecular Weight | 298.358 |
InChl | InChI=1/C12H14N2.CH4O4S/c1-9-4-5-10-8-11(14(2)3)6-7-12(10)13-9;1-5-6(2,3)4/h4-8H,1-3H3;1H3,(H,2,3,4) |
CAS Registry Number | 71501-21-8 |
EINECS | 275-552-0 |
Molecular Structure | ![]() |
Siedepunkt | 489.6°C at 760 mmHg |
Flammpunkt | 249.9°C |
Dampfdruck | 2.12E-10mmHg at 25°C |
MSDS |