ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73623-09-3 propan-2-yl methyl(2-methylphenyl)carbamate |
|
| Produkt-Name | propan-2-yl methyl(2-methylphenyl)carbamate |
| Englischer Name | propan-2-yl methyl(2-methylphenyl)carbamate; |
| Molekulare Formel | C12H17NO2 |
| Molecular Weight | 207.2689 |
| InChl | InChI=1/C12H17NO2/c1-9(2)15-12(14)13(4)11-8-6-5-7-10(11)3/h5-9H,1-4H3 |
| CAS Registry Number | 73623-09-3 |
| Molecular Structure | ![]() |
| Dichte | 1.051g/cm3 |
| Siedepunkt | 277.8°C at 760 mmHg |
| Brechungsindex | 1.531 |
| Flammpunkt | 121.8°C |
| Dampfdruck | 0.00442mmHg at 25°C |
| MSDS | |