ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74416-84-5 Phenyl-5-butoxypyridin-2-carboxylat |
|
| Produkt-Name | Phenyl-5-butoxypyridin-2-carboxylat |
| Englischer Name | phenyl 5-butoxypyridine-2-carboxylate; |
| Molekulare Formel | C16H17NO3 |
| Molecular Weight | 271.3111 |
| InChl | InChI=1/C16H17NO3/c1-2-3-11-19-14-9-10-15(17-12-14)16(18)20-13-7-5-4-6-8-13/h4-10,12H,2-3,11H2,1H3 |
| CAS Registry Number | 74416-84-5 |
| Molecular Structure | ![]() |
| Dichte | 1.132g/cm3 |
| Siedepunkt | 424.9°C at 760 mmHg |
| Brechungsindex | 1.552 |
| Flammpunkt | 210.8°C |
| Dampfdruck | 1.99E-07mmHg at 25°C |
| MSDS | |