ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7510-30-7 2,4,6-tripentyl-1,3,5-trioxan |
|
| Produkt-Name | 2,4,6-tripentyl-1,3,5-trioxan |
| Synonyme | ; |
| Englischer Name | 2,4,6-tripentyl-1,3,5-trioxane; |
| Molekulare Formel | C18H36O3 |
| Molecular Weight | 300.4766 |
| InChl | InChI=1/C18H36O3/c1-4-7-10-13-16-19-17(14-11-8-5-2)21-18(20-16)15-12-9-6-3/h16-18H,4-15H2,1-3H3 |
| CAS Registry Number | 7510-30-7 |
| Molecular Structure | ![]() |
| Dichte | 0.881g/cm3 |
| Siedepunkt | 361.9°C at 760 mmHg |
| Brechungsindex | 1.431 |
| Flammpunkt | 122.1°C |
| Dampfdruck | 4.18E-05mmHg at 25°C |
| MSDS | |