ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75497-68-6 Prop-2-ensäure - Ethenol (1:1) |
|
| Produkt-Name | Prop-2-ensäure - Ethenol (1:1) |
| Synonyme | ; |
| Englischer Name | prop-2-enoic acid - ethenol (1:1); |
| Molekulare Formel | C5H8O3 |
| Molecular Weight | 116.1152 |
| InChl | InChI=1/C3H4O2.C2H4O/c1-2-3(4)5;1-2-3/h2H,1H2,(H,4,5);2-3H,1H2 |
| CAS Registry Number | 75497-68-6 |
| Molecular Structure | ![]() |
| Siedepunkt | 141°C at 760 mmHg |
| Flammpunkt | 61.6°C |
| Dampfdruck | 3.42mmHg at 25°C |
| MSDS | |