ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76532-26-8 N~6~-(9H-fluoren-2-ylmethyl)-N~6~-methylpteridine-2,4,6-triamine |
|
| Produkt-Name | N~6~-(9H-fluoren-2-ylmethyl)-N~6~-methylpteridine-2,4,6-triamine |
| Englischer Name | N~6~-(9H-fluoren-2-ylmethyl)-N~6~-methylpteridine-2,4,6-triamine;2,4,6-pteridinetriamine, N~6~-(9H-fluoren-2-ylmethyl)-N~6~-methyl- |
| Molekulare Formel | C21H19N7 |
| Molecular Weight | 369.4225 |
| InChl | InChI=1/C21H19N7/c1-28(17-10-24-20-18(25-17)19(22)26-21(23)27-20)11-12-6-7-16-14(8-12)9-13-4-2-3-5-15(13)16/h2-8,10H,9,11H2,1H3,(H4,22,23,24,26,27) |
| CAS Registry Number | 76532-26-8 |
| Molecular Structure | ![]() |
| Dichte | 1.428g/cm3 |
| Siedepunkt | 707.5°C at 760 mmHg |
| Brechungsindex | 1.807 |
| Flammpunkt | 381.7°C |
| Dampfdruck | 7.32E-20mmHg at 25°C |
| MSDS | |