ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76765-22-5 Propan-2-yl 3-[(1E)-3,3-dimethyltriaz-1-en-1-yl]-4-methylbenzoat |
|
| Produkt-Name | Propan-2-yl 3-[(1E)-3,3-dimethyltriaz-1-en-1-yl]-4-methylbenzoat |
| Synonyme | Isopropyl-3-(3,3-dimethyl-1-triazenyl)-4-methylbenzoat; |
| Englischer Name | propan-2-yl 3-[(1E)-3,3-dimethyltriaz-1-en-1-yl]-4-methylbenzoate;Isopropyl 3-(3,3-dimethyl-1-triazenyl)-4-methylbenzoate |
| Molekulare Formel | C13H19N3O2 |
| Molecular Weight | 249.3089 |
| InChl | InChI=1/C13H19N3O2/c1-9(2)18-13(17)11-7-6-10(3)12(8-11)14-15-16(4)5/h6-9H,1-5H3/b15-14+ |
| CAS Registry Number | 76765-22-5 |
| Molecular Structure | ![]() |
| Dichte | 1.06g/cm3 |
| Siedepunkt | 349.2°C at 760 mmHg |
| Brechungsindex | 1.523 |
| Flammpunkt | 165°C |
| Dampfdruck | 4.77E-05mmHg at 25°C |
| MSDS | |