ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-79-2 Butadiene sulfone |
|
| Produkt-Name | Butadiene sulfone |
| Englischer Name | Butadiene sulfone;2,5-Dihydrothiophene-1,1-dioxide;3-Sulfolene;Dihydrothiophene-1,1-dioxide;Butadiene sulphone;Cyclobutenesulfone |
| Molekulare Formel | C4H6O2S |
| Molecular Weight | 118.15 |
| InChl | InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| CAS Registry Number | 77-79-2 |
| EINECS | 201-059-7 |
| Molecular Structure | ![]() |
| Dichte | 1.314 |
| Schmelzpunkt | 63-66℃ |
| Flammpunkt | 112℃ |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |