ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
801-98-9 4-[2-(5,8-dimethoxyquinolin-4-yl)ethenyl]-N,N-dimethylaniline |
|
| Produkt-Name | 4-[2-(5,8-dimethoxyquinolin-4-yl)ethenyl]-N,N-dimethylaniline |
| Englischer Name | 4-[2-(5,8-dimethoxyquinolin-4-yl)ethenyl]-N,N-dimethylaniline; |
| Molekulare Formel | C21H22N2O2 |
| Molecular Weight | 334.4116 |
| InChl | InChI=1/C21H22N2O2/c1-23(2)17-9-6-15(7-10-17)5-8-16-13-14-22-21-19(25-4)12-11-18(24-3)20(16)21/h5-14H,1-4H3 |
| CAS Registry Number | 801-98-9 |
| Molecular Structure | ![]() |
| Dichte | 1.169g/cm3 |
| Siedepunkt | 527.5°C at 760 mmHg |
| Brechungsindex | 1.673 |
| Flammpunkt | 272.8°C |
| Dampfdruck | 3.23E-11mmHg at 25°C |
| MSDS | |