ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
808-57-1 2,3,6,7,10,11-hexamethoxytriphenylene |
|
| Produkt-Name | 2,3,6,7,10,11-hexamethoxytriphenylene |
| Englischer Name | 2,3,6,7,10,11-hexamethoxytriphenylene; |
| Molekulare Formel | C24H24O6 |
| Molecular Weight | 408.4438 |
| InChl | InChI=1/C24H24O6/c1-25-19-7-13-14(8-20(19)26-2)16-10-22(28-4)24(30-6)12-18(16)17-11-23(29-5)21(27-3)9-15(13)17/h7-12H,1-6H3 |
| CAS Registry Number | 808-57-1 |
| Molecular Structure | ![]() |
| Dichte | 1.216g/cm3 |
| Siedepunkt | 578.6°C at 760 mmHg |
| Brechungsindex | 1.632 |
| Flammpunkt | 235.8°C |
| Dampfdruck | 8.81E-13mmHg at 25°C |
| MSDS | |