ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-16-0 Methyl-2-ethylpentanoat |
|
| Produkt-Name | Methyl-2-ethylpentanoat |
| Synonyme | ; Methyl-2-ethylpentanoat; Pentansäure, 2-ethyl-, methylester; Valeriansäure, 2-ethyl-, methylester; |
| Englischer Name | methyl 2-ethylpentanoate;Methyl 2-ethylpentanoate;Pentanoic acid, 2-ethyl-, methyl ester;Valeric acid, 2-ethyl-, methyl ester |
| Molekulare Formel | C8H16O2 |
| Molecular Weight | 144.2114 |
| InChl | InChI=1/C8H16O2/c1-4-6-7(5-2)8(9)10-3/h7H,4-6H2,1-3H3 |
| CAS Registry Number | 816-16-0 |
| Molecular Structure | ![]() |
| Dichte | 0.876g/cm3 |
| Siedepunkt | 156.3°C at 760 mmHg |
| Brechungsindex | 1.411 |
| Flammpunkt | 46.7°C |
| Dampfdruck | 2.91mmHg at 25°C |
| MSDS | |