ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-79-5 3-Ethylpent-2-en |
|
| Produkt-Name | 3-Ethylpent-2-en |
| Synonyme | 3-Ethyl-2-penten; |
| Englischer Name | 3-ethylpent-2-ene;3-Ethyl-2-pentene |
| Molekulare Formel | C7H14 |
| Molecular Weight | 98.1861 |
| InChl | InChI=1/C7H14/c1-4-7(5-2)6-3/h4H,5-6H2,1-3H3 |
| CAS Registry Number | 816-79-5 |
| EINECS | 212-438-1 |
| Molecular Structure | ![]() |
| Dichte | 0.714g/cm3 |
| Siedepunkt | 93.4°C at 760 mmHg |
| Brechungsindex | 1.414 |
| Dampfdruck | 56.4mmHg at 25°C |
| MSDS | |