ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-88-2 phenindamine |
|
| Produkt-Name | phenindamine |
| Englischer Name | phenindamine;1,2,3,4-Tetrahydro-2-methyl-9-phenyl-2-azafluorene;1H-indeno[2,1-c]pyridine, 2,3,4,9-tetrahydro-2-methyl-9-phenyl-;2,3,4,9-Tetrahydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine;2-Methyl-9-phenyl-2,3,4,9-tetrahydro-1H-indeno[2,1-c]pyridine;2-Methyl-9-phenyl-2,3,4,9-tetrahydro-1-pyridindene |
| Molekulare Formel | C19H19N |
| Molecular Weight | 261.3609 |
| InChl | InChI=1/C19H19N/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14/h2-10,19H,11-13H2,1H3 |
| CAS Registry Number | 82-88-2 |
| EINECS | 201-443-4 |
| Molecular Structure | ![]() |
| Dichte | 1.15g/cm3 |
| Siedepunkt | 416.5°C at 760 mmHg |
| Brechungsindex | 1.652 |
| Flammpunkt | 183°C |
| Dampfdruck | 3.8E-07mmHg at 25°C |
| MSDS | |