ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-93-9 Chlorcyclizine |
|
| Produkt-Name | Chlorcyclizine |
| Englischer Name | Chlorcyclizine; |
| Molekulare Formel | C18H21ClN2 |
| Molecular Weight | 300.8255 |
| InChl | InChI=1S/C18H21ClN2/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3 |
| CAS Registry Number | 82-93-9 |
| EINECS | 201-446-0 |
| Molecular Structure | ![]() |
| MSDS | |