ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823786-21-6 4-[(4-{[4-(hydroxymethyl)-2,6-dimethylphenyl]amino}pyrimidin-2-yl)amino]benzonitril |
|
| Produkt-Name | 4-[(4-{[4-(hydroxymethyl)-2,6-dimethylphenyl]amino}pyrimidin-2-yl)amino]benzonitril |
| Englischer Name | 4-[(4-{[4-(hydroxymethyl)-2,6-dimethylphenyl]amino}pyrimidin-2-yl)amino]benzonitrile; |
| Molekulare Formel | C20H19N5O |
| Molecular Weight | 345.3978 |
| InChl | InChI=1/C20H19N5O/c1-13-9-16(12-26)10-14(2)19(13)24-18-7-8-22-20(25-18)23-17-5-3-15(11-21)4-6-17/h3-10,26H,12H2,1-2H3,(H2,22,23,24,25) |
| CAS Registry Number | 823786-21-6 |
| Molecular Structure | ![]() |
| Dichte | 1.3g/cm3 |
| Siedepunkt | 601.8°C at 760 mmHg |
| Brechungsindex | 1.67 |
| Flammpunkt | 317.7°C |
| Dampfdruck | 2.48E-15mmHg at 25°C |
| MSDS | |