ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-78-2 Sodium 4-nitrophenoxide, hydrate |
|
| Produkt-Name | Sodium 4-nitrophenoxide, hydrate |
| Englischer Name | Sodium 4-nitrophenoxide, hydrate;4-Nitrophenol sodium salt;sodium p-nitrophenolate;4-Nitropheol Sodium Salt;P-Nitro phenol sodium salt;Sodium 4-nitrophenoxide;sodium 4-nitrophenolate |
| Molekulare Formel | C6H4NNaO3 |
| Molecular Weight | 161.0906 |
| InChl | InChI=1/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1 |
| CAS Registry Number | 824-78-2 |
| EINECS | 212-536-4 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 300℃ |
| Siedepunkt | 279°C at 760 mmHg |
| Flammpunkt | 141.9°C |
| Dampfdruck | 0.00243mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R20/21/22||R33:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |