ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-01-2 Diphenylcarbamyl chloride |
|
| Produkt-Name | Diphenylcarbamyl chloride |
| Englischer Name | Diphenylcarbamyl chloride;Diphenylcarbamoyl chloride;diphenylcarbamic chloride;N,N-Diphenylcarbamyl chloride |
| Molekulare Formel | C13H10ClNO |
| Molecular Weight | 231.6776 |
| InChl | InChI=1/C13H10ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| CAS Registry Number | 83-01-2 |
| EINECS | 201-450-2 |
| Molecular Structure | ![]() |
| Dichte | 1.269g/cm3 |
| Schmelzpunkt | 81-85℃ |
| Siedepunkt | 361.8°C at 760 mmHg |
| Brechungsindex | 1.633 |
| Flammpunkt | 172.6°C |
| Wasserlöslichkeit | reacts |
| Dampfdruck | 2.02E-05mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R29||R34:; |
| Safety Beschreibung | S26||S28A||S36/37/39||S45:; |
| MSDS | |