ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-89-6 mepacrine |
|
| Produkt-Name | mepacrine |
| Englischer Name | mepacrine;4-(3-chloro-7-methoxyacridin-9-ylamino)pentyldiethylamine |
| Molekulare Formel | C23H30ClN3O |
| Molecular Weight | 399.9625 |
| InChl | InChI=1/C23H30ClN3O/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26) |
| CAS Registry Number | 83-89-6 |
| EINECS | 201-508-7 |
| Molecular Structure | ![]() |
| MSDS | |