ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-94-3 Tabernanthin |
|
| Produkt-Name | Tabernanthin |
| Synonyme | Tabernanthin; 13-Methoxyibogamin; (2alpha)-13-methoxyibogamin; |
| Englischer Name | tabernanthine;Tabernanthine;13-Methoxyibogamine;(2alpha)-13-methoxyibogamine |
| Molekulare Formel | C20H26N2O |
| Molecular Weight | 310.4332 |
| InChl | InChI=1/C20H26N2O/c1-3-13-8-12-9-17-19-16(6-7-22(11-12)20(13)17)15-5-4-14(23-2)10-18(15)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
| CAS Registry Number | 83-94-3 |
| Molecular Structure | ![]() |
| Dichte | 1.2g/cm3 |
| Siedepunkt | 484.2°C at 760 mmHg |
| Brechungsindex | 1.643 |
| Flammpunkt | 246.6°C |
| Dampfdruck | 1.57E-09mmHg at 25°C |
| MSDS | |