ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-81-1 prenylmenaquinone-6 |
|
| Produkt-Name | prenylmenaquinone-6 |
| Englischer Name | prenylmenaquinone-6;vitamin K2(30);2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-3-methylnaphthalene-1,4-dione |
| Molekulare Formel | C41H56O2 |
| Molecular Weight | 580.8821 |
| InChl | InChI=1/C41H56O2/c1-30(2)16-11-17-31(3)18-12-19-32(4)20-13-21-33(5)22-14-23-34(6)24-15-25-35(7)28-29-37-36(8)40(42)38-26-9-10-27-39(38)41(37)43/h9-10,16,18,20,22,24,26-28H,11-15,17,19,21,23,25,29H2,1-8H3/b31-18+,32-20+,33-22+,34-24+,35-28+ |
| CAS Registry Number | 84-81-1 |
| Molecular Structure | ![]() |
| Dichte | 0.97g/cm3 |
| Schmelzpunkt | 49-50℃ |
| Siedepunkt | 673.3°C at 760 mmHg |
| Brechungsindex | 1.533 |
| Flammpunkt | 240.7°C |
| Dampfdruck | 5.49E-18mmHg at 25°C |
| MSDS | |