ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84255-45-8 1-(1,3-Diphenylbutyl)-4-ethylbenzol |
|
| Produkt-Name | 1-(1,3-Diphenylbutyl)-4-ethylbenzol |
| Synonyme | 1-(1,3-Diphenylbutyl)-4-ethylbenzol |
| Englischer Name | 1-(1,3-diphenylbutyl)-4-ethylbenzene;1-(1,3-Diphenylbutyl)-4-ethylbenzene |
| Molekulare Formel | C24H26 |
| Molecular Weight | 314.4632 |
| InChl | InChI=1/C24H26/c1-3-20-14-16-23(17-15-20)24(22-12-8-5-9-13-22)18-19(2)21-10-6-4-7-11-21/h4-17,19,24H,3,18H2,1-2H3 |
| CAS Registry Number | 84255-45-8 |
| EINECS | 282-594-3 |
| Molecular Structure | ![]() |
| Dichte | 1.003g/cm3 |
| Siedepunkt | 417.3°C at 760 mmHg |
| Brechungsindex | 1.574 |
| Flammpunkt | 204.5°C |
| Dampfdruck | 8.64E-07mmHg at 25°C |
| MSDS | |