ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84962-33-4 L-Glutaminsäure, Verbindung mit 5-Oxo-L-Prolin (1:1) |
|
Produkt-Name | L-Glutaminsäure, Verbindung mit 5-Oxo-L-Prolin (1:1) |
Synonyme | L-Glutaminsäure, Verbindung mit 5-Oxo-L-Prolin (1:1); (2S)-2-Aminopentandionsäure; (2S)-5-oxopyrrolidin-2-carbonsäure; |
Englischer Name | L-glutamic acid, compound with 5-oxo-L-proline (1:1);L-Glutamic acid, compound with 5-oxo-L-proline (1:1);(2S)-2-aminopentanedioic acid; (2S)-5-oxopyrrolidine-2-carboxylic acid |
Molekulare Formel | C10H16N2O7 |
Molecular Weight | 276.2432 |
InChl | InChI=1/C5H9NO4.C5H7NO3/c6-3(5(9)10)1-2-4(7)8;7-4-2-1-3(6-4)5(8)9/h3H,1-2,6H2,(H,7,8)(H,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t2*3-/m00/s1 |
CAS Registry Number | 84962-33-4 |
EINECS | 284-730-7 |
Molecular Structure | ![]() |
Siedepunkt | 657.1°C at 760 mmHg |
Flammpunkt | 351.2°C |
Dampfdruck | 5.82E-19mmHg at 25°C |
MSDS |