ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-84-7 Solvent Yellow 5 |
|
| Produkt-Name | Solvent Yellow 5 |
| Englischer Name | Solvent Yellow 5;C.I. 11380;C.I. Food Yellow 10;C.I. Solvent Yellow 5;C.I. Solvent Yellow 5 (8CI);1-[(E)-phenyldiazenyl]naphthalen-2-amine;1-(phenyldiazenyl)naphthalen-2-amine |
| Molekulare Formel | C16H13N3 |
| Molecular Weight | 247.2945 |
| InChl | InChI=1/C16H13N3/c17-15-11-10-12-6-4-5-9-14(12)16(15)19-18-13-7-2-1-3-8-13/h1-11H,17H2 |
| CAS Registry Number | 85-84-7 |
| EINECS | 201-636-3 |
| Molecular Structure | ![]() |
| Dichte | 1.173g/cm3 |
| Siedepunkt | 458.035°C at 760 mmHg |
| Brechungsindex | 1.647 |
| Flammpunkt | 230.811°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |