ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-97-2 3-chlorobiphenyl-2-ol |
|
| Produkt-Name | 3-chlorobiphenyl-2-ol |
| Englischer Name | 3-chlorobiphenyl-2-ol;2-chloro-6-phenylphenol;2-phenyl-6-chlorophenol |
| Molekulare Formel | C12H9ClO |
| Molecular Weight | 204.65 |
| InChl | InChI=1/C12H9ClO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,14H |
| CAS Registry Number | 85-97-2 |
| EINECS | 201-644-7 |
| Molecular Structure | ![]() |
| MSDS | |